C16H32O2 — CID 88697321
2,6-dimethylheptan-4-one;5-methylhexan-2-one (PubChem CID 88697321) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-one;5-methylhexan-2-one.
| Compound Name | 2,6-dimethylheptan-4-one;5-methylhexan-2-one |
|---|---|
| PubChem CID | 88697321 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2,6-dimethylheptan-4-one;5-methylhexan-2-one |
| SMILES | CC(=O)CCC(C)C.CC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C9H18O.C7H14O/c1-7(2)5-9(10)6-8(3)4;1-6(2)4-5-7(3)8/h7-8H,5-6H2,1-4H3;6H,4-5H2,1-3H3 |
| InChIKey | LJTDTYBESQFDLR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |