C12H22O2 — CID 152780076
2,9-dimethyldecane-4,6-dione (PubChem CID 152780076) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,9-dimethyldecane-4,6-dione.
| Compound Name | 2,9-dimethyldecane-4,6-dione |
|---|---|
| PubChem CID | 152780076 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,9-dimethyldecane-4,6-dione |
| SMILES | CC(C)CCC(=O)CC(=O)CC(C)C |
| InChI | InChI=1S/C12H22O2/c1-9(2)5-6-11(13)8-12(14)7-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | KGTZSFQLHRMVBI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|