C15H30N2O2 — CID 142658996
4-methyl-N'-(3-methylbutanoyl)-N'-(2-methylpropyl)pentanehydrazide (PubChem CID 142658996) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-methyl-N'-(3-methylbutanoyl)-N'-(2-methylpropyl)pentanehydrazide.
| Compound Name | 4-methyl-N'-(3-methylbutanoyl)-N'-(2-methylpropyl)pentanehydrazide |
|---|---|
| PubChem CID | 142658996 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 4-methyl-N'-(3-methylbutanoyl)-N'-(2-methylpropyl)pentanehydrazide |
| SMILES | CC(C)CCC(=O)NN(CC(C)C)C(=O)CC(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-11(2)7-8-14(18)16-17(10-13(5)6)15(19)9-12(3)4/h11-13H,7-10H2,1-6H3,(H,16,18) |
| InChIKey | HLQLPXLHHQJBHB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|