(E)-3,6-dimethylhept-2-enoic acid

C9H16O2 — CID 21291054

IUPAC(E)-3,6-dimethylhept-2-enoic acid
SMILESC/C(=C\C(=O)O)CCC(C)C
InChIInChI=1S/C9H16O2/c1-7(2)4-5-8(3)6-9(10)11/h6-7H,4-5H2,1-3H3,(H,10,11)/b8-6+
InChIKeyDRMVBIAPSBLQKZ-SOFGYWHQSA-N
MW156.22 g/mol
LogP2.45
Rot. Bonds4

About (E)-3,6-dimethylhept-2-enoic acid

(E)-3,6-dimethylhept-2-enoic acid (PubChem CID 21291054) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (E)-3,6-dimethylhept-2-enoic acid.

Molecular Properties

Compound Name(E)-3,6-dimethylhept-2-enoic acid
PubChem CID21291054
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Name(E)-3,6-dimethylhept-2-enoic acid
SMILESC/C(=C\C(=O)O)CCC(C)C
InChIInChI=1S/C9H16O2/c1-7(2)4-5-8(3)6-9(10)11/h6-7H,4-5H2,1-3H3,(H,10,11)/b8-6+
InChIKeyDRMVBIAPSBLQKZ-SOFGYWHQSA-N
XLogP2.45
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3,6-dimethylhept-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3,6-dimethylhept-2-enoic acid?
The IUPAC name of (E)-3,6-dimethylhept-2-enoic acid (CID 21291054) is (E)-3,6-dimethylhept-2-enoic acid.
What is the SMILES notation for (E)-3,6-dimethylhept-2-enoic acid?
The canonical SMILES for (E)-3,6-dimethylhept-2-enoic acid is C/C(=C\C(=O)O)CCC(C)C.
What is the InChIKey of (E)-3,6-dimethylhept-2-enoic acid?
The InChIKey is DRMVBIAPSBLQKZ-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H16O2/c1-7(2)4-5-8(3)6-9(10)11/h6-7H,4-5H2,1-3H3,(H,10,11)/b8-6+.
What are the key properties of (E)-3,6-dimethylhept-2-enoic acid?
(E)-3,6-dimethylhept-2-enoic acid has a molecular weight of 156.22 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,6-dimethylhept-2-enoic acid is sourced from PubChem (CID 21291054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).