C10H18N2O2 — CID 130995825
5-(2,2-dimethylpropyl)-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 130995825) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-1,3-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-(2,2-dimethylpropyl)-1,3-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130995825 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(CC(C)(C)C)N(C)C1=O |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,3)6-7-8(13)12(5)9(14)11(7)4/h7H,6H2,1-5H3 |
| InChIKey | MKBBLWSQSSILJU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|