C7H9N3O2 — CID 84765176
2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetonitrile (PubChem CID 84765176) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetonitrile.
| Compound Name | 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetonitrile |
|---|---|
| PubChem CID | 84765176 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetonitrile |
| SMILES | CN1C(=O)C(CC#N)N(C)C1=O |
| InChI | InChI=1S/C7H9N3O2/c1-9-5(3-4-8)6(11)10(2)7(9)12/h5H,3H2,1-2H3 |
| InChIKey | GHZZHWRSUZJXMV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|