C13H15N5O4 — CID 101160655
(1S,2S,7S,8S)-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile (PubChem CID 101160655) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is (1S,2S,7S,8S)-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile.
| Compound Name | (1S,2S,7S,8S)-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile |
|---|---|
| PubChem CID | 101160655 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (1S,2S,7S,8S)-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile |
| SMILES | CN1C(=O)[C@@H]2[C@H](N(C)C1=O)[C@]1(C#N)[C@H]2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C13H15N5O4/c1-15-8-6(9(19)16(2)11(15)21)7-10(20)17(3)12(22)18(4)13(7,8)5-14/h6-8H,1-4H3/t6-,7+,8-,13-/m0/s1 |
| InChIKey | FLBAEIBIPKZWLO-BLDDZIHTSA-N |
| XLogP | -1.09 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |