C13H14FN5O4 — CID 101160650
(1R,2R,7R,8R)-7-fluoro-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile (PubChem CID 101160650) has the molecular formula C13H14FN5O4 and a molecular weight of 323.28 g/mol. Its IUPAC name is (1R,2R,7R,8R)-7-fluoro-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile.
| Compound Name | (1R,2R,7R,8R)-7-fluoro-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile |
|---|---|
| PubChem CID | 101160650 |
| Molecular Formula | C13H14FN5O4 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (1R,2R,7R,8R)-7-fluoro-3,5,10,12-tetramethyl-4,6,9,11-tetraoxo-3,5,10,12-tetrazatricyclo[6.4.0.02,7]dodecane-1-carbonitrile |
| SMILES | CN1C(=O)[C@@H]2[C@]3(F)C(=O)N(C)C(=O)N(C)[C@@H]3[C@]2(C#N)N(C)C1=O |
| InChI | InChI=1S/C13H14FN5O4/c1-16-7(20)6-12(5-15,19(4)11(16)23)8-13(6,14)9(21)18(3)10(22)17(8)2/h6,8H,1-4H3/t6-,8+,12+,13+/m0/s1 |
| InChIKey | JPZNJQBTGMOYNV-HZAVFWJMSA-N |
| XLogP | -1.00 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |