C15H17N3O3 — CID 97110330
(5R)-5-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 97110330) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (5R)-5-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97110330 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (5R)-5-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl]-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)[C@@H](CC(=O)N2Cc3ccccc3C2)N(C)C1=O |
| InChI | InChI=1S/C15H17N3O3/c1-16-12(14(20)17(2)15(16)21)7-13(19)18-8-10-5-3-4-6-11(10)9-18/h3-6,12H,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | FRDFIHKVHRZTBE-GFCCVEGCSA-N |
| XLogP | 0.81 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|