C14H21N3O3 — CID 95502097
N-(cyclohexen-1-ylmethyl)-2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 95502097) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(cyclohexen-1-ylmethyl)-2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(cyclohexen-1-ylmethyl)-2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 95502097 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(cyclohexen-1-ylmethyl)-2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CN1C(=O)[C@@H](CC(=O)NCC2=CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C14H21N3O3/c1-16-11(13(19)17(2)14(16)20)8-12(18)15-9-10-6-4-3-5-7-10/h6,11H,3-5,7-9H2,1-2H3,(H,15,18)/t11-/m1/s1 |
| InChIKey | WODAFEXGLOKEIX-LLVKDONJSA-N |
| XLogP | 0.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|