C13H26N2O2 — CID 170316861
cyclopenten-1-ylmethylcarbamic acid;N,N-diethylethanamine (PubChem CID 170316861) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is cyclopenten-1-ylmethylcarbamic acid;N,N-diethylethanamine.
| Compound Name | cyclopenten-1-ylmethylcarbamic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 170316861 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | cyclopenten-1-ylmethylcarbamic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.O=C(O)NCC1=CCCC1 |
| InChI | InChI=1S/C7H11NO2.C6H15N/c9-7(10)8-5-6-3-1-2-4-6;1-4-7(5-2)6-3/h3,8H,1-2,4-5H2,(H,9,10);4-6H2,1-3H3 |
| InChIKey | IEWJXNVAECTPCC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|