C16H20N2O3 — CID 122015864
4-[(cyclohexen-1-ylmethylcarbamoylamino)methyl]benzoic acid (PubChem CID 122015864) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[(cyclohexen-1-ylmethylcarbamoylamino)methyl]benzoic acid.
| Compound Name | 4-[(cyclohexen-1-ylmethylcarbamoylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 122015864 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[(cyclohexen-1-ylmethylcarbamoylamino)methyl]benzoic acid |
| SMILES | O=C(NCC1=CCCCC1)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H20N2O3/c19-15(20)14-8-6-13(7-9-14)11-18-16(21)17-10-12-4-2-1-3-5-12/h4,6-9H,1-3,5,10-11H2,(H,19,20)(H2,17,18,21) |
| InChIKey | FASYYLKHDHVMOC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|