C17H19N3O4 — CID 97118509
2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[(3-methyl-1-benzofuran-2-yl)methyl]acetamide (PubChem CID 97118509) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[(3-methyl-1-benzofuran-2-yl)methyl]acetamide.
| Compound Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[(3-methyl-1-benzofuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 97118509 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[(3-methyl-1-benzofuran-2-yl)methyl]acetamide |
| SMILES | Cc1c(CNC(=O)C[C@H]2C(=O)N(C)C(=O)N2C)oc2ccccc12 |
| InChI | InChI=1S/C17H19N3O4/c1-10-11-6-4-5-7-13(11)24-14(10)9-18-15(21)8-12-16(22)20(3)17(23)19(12)2/h4-7,12H,8-9H2,1-3H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | BDMJWACTAPJMSB-LBPRGKRZSA-N |
| XLogP | 1.64 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|