C15H20N2O2 — CID 82121457
5-(4-tert-butylphenyl)-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 82121457) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-1,3-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-(4-tert-butylphenyl)-1,3-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82121457 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 5-(4-tert-butylphenyl)-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(c2ccc(C(C)(C)C)cc2)N(C)C1=O |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,3)11-8-6-10(7-9-11)12-13(18)17(5)14(19)16(12)4/h6-9,12H,1-5H3 |
| InChIKey | HRKPVEZEDVWJQG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|