C20H20N4O3 — CID 102592111
1-(4-tert-butylphenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile (PubChem CID 102592111) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile.
| Compound Name | 1-(4-tert-butylphenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile |
|---|---|
| PubChem CID | 102592111 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile |
| SMILES | CN1C(=O)N(C)C(=O)C2(C1=O)C(c1ccc(C(C)(C)C)cc1)C2(C#N)C#N |
| InChI | InChI=1S/C20H20N4O3/c1-18(2,3)13-8-6-12(7-9-13)14-19(10-21,11-22)20(14)15(25)23(4)17(27)24(5)16(20)26/h6-9,14H,1-5H3 |
| InChIKey | WYNJBSGTZCSYPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|