C16H11ClN4O3 — CID 91741869
1-(2-chlorophenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile (PubChem CID 91741869) has the molecular formula C16H11ClN4O3 and a molecular weight of 342.74 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile.
| Compound Name | 1-(2-chlorophenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile |
|---|---|
| PubChem CID | 91741869 |
| Molecular Formula | C16H11ClN4O3 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-(2-chlorophenyl)-5,7-dimethyl-4,6,8-trioxo-5,7-diazaspiro[2.5]octane-2,2-dicarbonitrile |
| SMILES | CN1C(=O)N(C)C(=O)C2(C1=O)C(c1ccccc1Cl)C2(C#N)C#N |
| InChI | InChI=1S/C16H11ClN4O3/c1-20-12(22)16(13(23)21(2)14(20)24)11(15(16,7-18)8-19)9-5-3-4-6-10(9)17/h3-6,11H,1-2H3 |
| InChIKey | AHDBYOPTVZBUNB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 105.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|