C20H13ClN6O — CID 95166996
cis-(2R,3S)-3-(2-chlorophenyl)-2-(2,2-dicyano-1-morpholin-4-ylethenyl)cyclopropane-1,1,2-tricarbonitrile (PubChem CID 95166996) has the molecular formula C20H13ClN6O and a molecular weight of 388.82 g/mol. Its IUPAC name is cis-(2R,3S)-3-(2-chlorophenyl)-2-(2,2-dicyano-1-morpholin-4-ylethenyl)cyclopropane-1,1,2-tricarbonitrile.
| Compound Name | cis-(2R,3S)-3-(2-chlorophenyl)-2-(2,2-dicyano-1-morpholin-4-ylethenyl)cyclopropane-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 95166996 |
| Molecular Formula | C20H13ClN6O |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | cis-(2R,3S)-3-(2-chlorophenyl)-2-(2,2-dicyano-1-morpholin-4-ylethenyl)cyclopropane-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N1CCOCC1)[C@@]1(C#N)[C@H](c2ccccc2Cl)C1(C#N)C#N |
| InChI | InChI=1S/C20H13ClN6O/c21-16-4-2-1-3-15(16)17-19(11-24,12-25)20(17,13-26)18(14(9-22)10-23)27-5-7-28-8-6-27/h1-4,17H,5-8H2/t17-,20-/m1/s1 |
| InChIKey | PGOALIYKPGHXRO-YLJYHZDGSA-N |
| XLogP | 2.61 |
| TPSA | 131.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|