C16H21ClN2O2 — CID 91767867
1-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 91767867) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 91767867 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | O=C(CN1CCOCC1)N1CCC(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H21ClN2O2/c17-15-4-2-1-3-14(15)13-5-6-19(11-13)16(20)12-18-7-9-21-10-8-18/h1-4,13H,5-12H2 |
| InChIKey | ASHSZCZXQDKSKG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |