C14H18ClN3O2 — CID 119064064
1-[2-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]-1-methylurea (PubChem CID 119064064) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-[2-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]-1-methylurea.
| Compound Name | 1-[2-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]-1-methylurea |
|---|---|
| PubChem CID | 119064064 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[2-[3-(2-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]-1-methylurea |
| SMILES | CN(CC(=O)N1CCC(c2ccccc2Cl)C1)C(N)=O |
| InChI | InChI=1S/C14H18ClN3O2/c1-17(14(16)20)9-13(19)18-7-6-10(8-18)11-4-2-3-5-12(11)15/h2-5,10H,6-9H2,1H3,(H2,16,20) |
| InChIKey | FGBMDGYWFNORMX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |