C13H23N3O2 — CID 9490080
1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-methylurea (PubChem CID 9490080) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-methylurea.
| Compound Name | 1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-methylurea |
|---|---|
| PubChem CID | 9490080 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-1-methylurea |
| SMILES | CN(CC(=O)N1CC[C@@H]2CCCC[C@H]2C1)C(N)=O |
| InChI | InChI=1S/C13H23N3O2/c1-15(13(14)18)9-12(17)16-7-6-10-4-2-3-5-11(10)8-16/h10-11H,2-9H2,1H3,(H2,14,18)/t10-,11-/m0/s1 |
| InChIKey | HMRUVISKSYUXGO-QWRGUYRKSA-N |
| XLogP | 1.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |