C21H16N6 — CID 51688794
trans-(2S,3S)-2-(2,2-dicyano-1-piperidin-1-ylethenyl)-3-phenylcyclopropane-1,1,2-tricarbonitrile (PubChem CID 51688794) has the molecular formula C21H16N6 and a molecular weight of 352.40 g/mol. Its IUPAC name is trans-(2S,3S)-2-(2,2-dicyano-1-piperidin-1-ylethenyl)-3-phenylcyclopropane-1,1,2-tricarbonitrile.
| Compound Name | trans-(2S,3S)-2-(2,2-dicyano-1-piperidin-1-ylethenyl)-3-phenylcyclopropane-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 51688794 |
| Molecular Formula | C21H16N6 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | trans-(2S,3S)-2-(2,2-dicyano-1-piperidin-1-ylethenyl)-3-phenylcyclopropane-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N1CCCCC1)[C@]1(C#N)[C@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H16N6/c22-11-17(12-23)19(27-9-5-2-6-10-27)21(15-26)18(20(21,13-24)14-25)16-7-3-1-4-8-16/h1,3-4,7-8,18H,2,5-6,9-10H2/t18-,21+/m1/s1 |
| InChIKey | SRSOKKYNHVXFQA-NQIIRXRSSA-N |
| XLogP | 3.11 |
| TPSA | 122.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|