C16H18N4 — CID 87798940
2-[1-(4-phenyl-1,4-diazepan-1-yl)ethylidene]propanedinitrile (PubChem CID 87798940) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[1-(4-phenyl-1,4-diazepan-1-yl)ethylidene]propanedinitrile.
| Compound Name | 2-[1-(4-phenyl-1,4-diazepan-1-yl)ethylidene]propanedinitrile |
|---|---|
| PubChem CID | 87798940 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[1-(4-phenyl-1,4-diazepan-1-yl)ethylidene]propanedinitrile |
| SMILES | CC(=C(C#N)C#N)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H18N4/c1-14(15(12-17)13-18)19-8-5-9-20(11-10-19)16-6-3-2-4-7-16/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | AFIJAWMDWCOAPC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|