C14H20N2 — CID 123837973
1-phenyl-4-prop-1-en-2-yl-1,4-diazepane (PubChem CID 123837973) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-phenyl-4-prop-1-en-2-yl-1,4-diazepane.
| Compound Name | 1-phenyl-4-prop-1-en-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 123837973 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-phenyl-4-prop-1-en-2-yl-1,4-diazepane |
| SMILES | C=C(C)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N2/c1-13(2)15-9-6-10-16(12-11-15)14-7-4-3-5-8-14/h3-5,7-8H,1,6,9-12H2,2H3 |
| InChIKey | DKTUUSICAGGXIB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |