C15H19N5S — CID 90887678
2-cyano-3-(4-pyridin-3-yl-1,4-diazepan-1-yl)but-2-enethioamide (PubChem CID 90887678) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-cyano-3-(4-pyridin-3-yl-1,4-diazepan-1-yl)but-2-enethioamide.
| Compound Name | 2-cyano-3-(4-pyridin-3-yl-1,4-diazepan-1-yl)but-2-enethioamide |
|---|---|
| PubChem CID | 90887678 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-cyano-3-(4-pyridin-3-yl-1,4-diazepan-1-yl)but-2-enethioamide |
| SMILES | CC(=C(C#N)C(N)=S)N1CCCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C15H19N5S/c1-12(14(10-16)15(17)21)19-6-3-7-20(9-8-19)13-4-2-5-18-11-13/h2,4-5,11H,3,6-9H2,1H3,(H2,17,21) |
| InChIKey | OPYIPQHSSXUINS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|