C31H40N6O2S — CID 158963666
(Z)-3-[4-(4-acetylphenyl)-1,4-diazepan-1-yl]-2-cyanobut-2-enethioamide;1-[4-(1,4-diazepan-1-yl)phenyl]ethanone (PubChem CID 158963666) has the molecular formula C31H40N6O2S and a molecular weight of 560.77 g/mol. Its IUPAC name is (Z)-3-[4-(4-acetylphenyl)-1,4-diazepan-1-yl]-2-cyanobut-2-enethioamide;1-[4-(1,4-diazepan-1-yl)phenyl]ethanone.
| Compound Name | (Z)-3-[4-(4-acetylphenyl)-1,4-diazepan-1-yl]-2-cyanobut-2-enethioamide;1-[4-(1,4-diazepan-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 158963666 |
| Molecular Formula | C31H40N6O2S |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (Z)-3-[4-(4-acetylphenyl)-1,4-diazepan-1-yl]-2-cyanobut-2-enethioamide;1-[4-(1,4-diazepan-1-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCCN(/C(C)=C(/C#N)C(N)=S)CC2)cc1.CC(=O)c1ccc(N2CCCNCC2)cc1 |
| InChI | InChI=1S/C18H22N4OS.C13H18N2O/c1-13(17(12-19)18(20)24)21-8-3-9-22(11-10-21)16-6-4-15(5-7-16)14(2)23;1-11(16)12-3-5-13(6-4-12)15-9-2-7-14-8-10-15/h4-7H,3,8-11H2,1-2H3,(H2,20,24);3-6,14H,2,7-10H2,1H3/b17-13-; |
| InChIKey | JMXUWYHOQRHYCM-VSORCOHTSA-N |
| XLogP | 4.17 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|