C12H18ClN3O — CID 68552362
4-(1,4-diazepan-1-yl)benzamide;hydrochloride (PubChem CID 68552362) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)benzamide;hydrochloride.
| Compound Name | 4-(1,4-diazepan-1-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 68552362 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(N2CCCNCC2)cc1 |
| InChI | InChI=1S/C12H17N3O.ClH/c13-12(16)10-2-4-11(5-3-10)15-8-1-6-14-7-9-15;/h2-5,14H,1,6-9H2,(H2,13,16);1H |
| InChIKey | OJJPTFRNDMOMKU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |