C23H22N6O — CID 126470689
4-[3-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide (PubChem CID 126470689) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[3-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide.
| Compound Name | 4-[3-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 126470689 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[3-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc3c(-c4ccc(N5CCNCC5)cc4)[nH]nc3n2)cc1 |
| InChI | InChI=1S/C23H22N6O/c24-22(30)17-3-1-15(2-4-17)20-10-9-19-21(27-28-23(19)26-20)16-5-7-18(8-6-16)29-13-11-25-12-14-29/h1-10,25H,11-14H2,(H2,24,30)(H,26,27,28) |
| InChIKey | XNVOWVUJZPDORX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |