C11H18Cl2N4O — CID 155943283
2-(1,4-diazepan-1-yl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 155943283) has the molecular formula C11H18Cl2N4O and a molecular weight of 293.20 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | 2-(1,4-diazepan-1-yl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155943283 |
| Molecular Formula | C11H18Cl2N4O |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1cccnc1N1CCCNCC1 |
| InChI | InChI=1S/C11H16N4O.2ClH/c12-10(16)9-3-1-5-14-11(9)15-7-2-4-13-6-8-15;;/h1,3,5,13H,2,4,6-8H2,(H2,12,16);2*1H |
| InChIKey | PWOPXNVWQFJYJM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |