C14H19N5O — CID 18428086
2-(1,4-diazepan-1-yl)-1-methylbenzimidazole-4-carboxamide (PubChem CID 18428086) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-1-methylbenzimidazole-4-carboxamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-1-methylbenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 18428086 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-1-methylbenzimidazole-4-carboxamide |
| SMILES | Cn1c(N2CCCNCC2)nc2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C14H19N5O/c1-18-11-5-2-4-10(13(15)20)12(11)17-14(18)19-8-3-6-16-7-9-19/h2,4-5,16H,3,6-9H2,1H3,(H2,15,20) |
| InChIKey | BWZWKZMLGVKKTD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |