C19H21N5O — CID 68701798
2-[4-(1,4-diazepan-1-yl)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 68701798) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[4-(1,4-diazepan-1-yl)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[4-(1,4-diazepan-1-yl)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 68701798 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[4-(1,4-diazepan-1-yl)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2[nH]c(-c3ccc(N4CCCNCC4)cc3)nc12 |
| InChI | InChI=1S/C19H21N5O/c20-18(25)15-3-1-4-16-17(15)23-19(22-16)13-5-7-14(8-6-13)24-11-2-9-21-10-12-24/h1,3-8,21H,2,9-12H2,(H2,20,25)(H,22,23) |
| InChIKey | FOUJPLPRSKJFOT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|