C18H17Cl2N5O — CID 44542664
2-[4-(1-methylpyrazol-3-yl)phenyl]-1H-benzimidazole-4-carboxamide;dihydrochloride (PubChem CID 44542664) has the molecular formula C18H17Cl2N5O and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-[4-(1-methylpyrazol-3-yl)phenyl]-1H-benzimidazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-[4-(1-methylpyrazol-3-yl)phenyl]-1H-benzimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 44542664 |
| Molecular Formula | C18H17Cl2N5O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-[4-(1-methylpyrazol-3-yl)phenyl]-1H-benzimidazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1ccc(-c2ccc(-c3nc4c(C(N)=O)cccc4[nH]3)cc2)n1 |
| InChI | InChI=1S/C18H15N5O.2ClH/c1-23-10-9-14(22-23)11-5-7-12(8-6-11)18-20-15-4-2-3-13(17(19)24)16(15)21-18;;/h2-10H,1H3,(H2,19,24)(H,20,21);2*1H |
| InChIKey | LPWKCWXKMJRCIU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |