C16H19N4O2 — CID 11243500
CID 11243500 (PubChem CID 11243500) has the molecular formula C16H19N4O2 and a molecular weight of 299.35 g/mol.
| Compound Name | CID 11243500 |
|---|---|
| PubChem CID | 11243500 |
| Molecular Formula | C16H19N4O2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | — |
| SMILES | CC1(C)C=C(c2nc3c(C(N)=O)cccc3[nH]2)C(C)(C)N1[O] |
| InChI | InChI=1S/C16H19N4O2/c1-15(2)8-10(16(3,4)20(15)22)14-18-11-7-5-6-9(13(17)21)12(11)19-14/h5-8H,1-4H3,(H2,17,21)(H,18,19) |
| InChIKey | UOSLONPTBPANJW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |