C16H23N5O3S — CID 11960921
2-[1-(dimethylsulfamoyl)-4-methylpiperidin-4-yl]-1H-benzimidazole-4-carboxamide (PubChem CID 11960921) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[1-(dimethylsulfamoyl)-4-methylpiperidin-4-yl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[1-(dimethylsulfamoyl)-4-methylpiperidin-4-yl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11960921 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[1-(dimethylsulfamoyl)-4-methylpiperidin-4-yl]-1H-benzimidazole-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(C)(c2nc3c(C(N)=O)cccc3[nH]2)CC1 |
| InChI | InChI=1S/C16H23N5O3S/c1-16(7-9-21(10-8-16)25(23,24)20(2)3)15-18-12-6-4-5-11(14(17)22)13(12)19-15/h4-6H,7-10H2,1-3H3,(H2,17,22)(H,18,19) |
| InChIKey | NFXMTMTZERSZCO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |