C10H9N5O — CID 135566422
6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one (PubChem CID 135566422) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is 6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one.
| Compound Name | 6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 135566422 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 6-amino-2-methyl-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
| SMILES | Cc1nc2cc3nc(N)[nH]c(=O)c3cc2[nH]1 |
| InChI | InChI=1S/C10H9N5O/c1-4-12-7-2-5-6(3-8(7)13-4)14-10(11)15-9(5)16/h2-3H,1H3,(H,12,13)(H3,11,14,15,16) |
| InChIKey | PLJNUNPYZVVIRA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |