C16H24Cl2N4O2 — CID 119890505
4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]benzamide;dihydrochloride (PubChem CID 119890505) has the molecular formula C16H24Cl2N4O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is 4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]benzamide;dihydrochloride.
| Compound Name | 4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119890505 |
| Molecular Formula | C16H24Cl2N4O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ccc(N2CCN(C(=O)C3CCCN3)CC2)cc1 |
| InChI | InChI=1S/C16H22N4O2.2ClH/c17-15(21)12-3-5-13(6-4-12)19-8-10-20(11-9-19)16(22)14-2-1-7-18-14;;/h3-6,14,18H,1-2,7-11H2,(H2,17,21);2*1H |
| InChIKey | KODZXPKWEYYSNX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |