C19H27N3O2 — CID 68550560
4-[4-(cyclohexanecarbonyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 68550560) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-[4-(cyclohexanecarbonyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 4-[4-(cyclohexanecarbonyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 68550560 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 4-[4-(cyclohexanecarbonyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCCN(C(=O)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O2/c20-18(23)15-7-9-17(10-8-15)21-11-4-12-22(14-13-21)19(24)16-5-2-1-3-6-16/h7-10,16H,1-6,11-14H2,(H2,20,23) |
| InChIKey | NZKGERGMGXSRMN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |