C19H25N3O2 — CID 98762392
4-[4-[(1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbonyl]piperazin-1-yl]benzamide (PubChem CID 98762392) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[4-[(1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbonyl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[(1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbonyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 98762392 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-[4-[(1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbonyl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(C(=O)[C@@H]3C[C@H]4CC[C@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c20-18(23)14-3-5-16(6-4-14)21-7-9-22(10-8-21)19(24)17-12-13-1-2-15(17)11-13/h3-6,13,15,17H,1-2,7-12H2,(H2,20,23)/t13-,15-,17+/m0/s1 |
| InChIKey | LRYIAPJWBQSNLL-JLJPHGGASA-N |
| XLogP | 1.87 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |