C16H20N4OS — CID 87798823
(E)-2-cyano-3-[4-(4-methoxyphenyl)piperazin-1-yl]but-2-enethioamide (PubChem CID 87798823) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(4-methoxyphenyl)piperazin-1-yl]but-2-enethioamide.
| Compound Name | (E)-2-cyano-3-[4-(4-methoxyphenyl)piperazin-1-yl]but-2-enethioamide |
|---|---|
| PubChem CID | 87798823 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (E)-2-cyano-3-[4-(4-methoxyphenyl)piperazin-1-yl]but-2-enethioamide |
| SMILES | COc1ccc(N2CCN(/C(C)=C(\C#N)C(N)=S)CC2)cc1 |
| InChI | InChI=1S/C16H20N4OS/c1-12(15(11-17)16(18)22)19-7-9-20(10-8-19)13-3-5-14(21-2)6-4-13/h3-6H,7-10H2,1-2H3,(H2,18,22)/b15-12+ |
| InChIKey | LKHSCKKDYUCXAY-NTCAYCPXSA-N |
| XLogP | 1.90 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|