About piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate
piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate (PubChem CID 159731714) has the molecular formula C20H30N4O2
and a molecular weight of 358.49 g/mol. Its IUPAC name is piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate.
Molecular Properties
| Compound Name | piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate |
| PubChem CID | 159731714 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate |
| SMILES | C1CNCCN1.CC(=O)c1ccc2cc(N3CCNCC3)ccc2c1.O |
| InChI | InChI=1S/C16H18N2O.C4H10N2.H2O/c1-12(19)13-2-3-15-11-16(5-4-14(15)10-13)18-8-6-17-7-9-18;1-2-6-4-3-5-1;/h2-5,10-11,17H,6-9H2,1H3;5-6H,1-4H2;1H2 |
| InChIKey | KYEFHJPEOKFZBU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate?
The IUPAC name of piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate (CID 159731714) is piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate.
What is the SMILES notation for piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate?
The canonical SMILES for piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate is C1CNCCN1.CC(=O)c1ccc2cc(N3CCNCC3)ccc2c1.O.
What is the InChIKey of piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate?
The InChIKey is KYEFHJPEOKFZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O.C4H10N2.H2O/c1-12(19)13-2-3-15-11-16(5-4-14(15)10-13)18-8-6-17-7-9-18;1-2-6-4-3-5-1;/h2-5,10-11,17H,6-9H2,1H3;5-6H,1-4H2;1H2.
What are the key properties of piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate?
piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate has a molecular weight of 358.49 g/mol, XLogP of 0.81, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;1-(6-piperazin-1-ylnaphthalen-2-yl)ethanone;hydrate is sourced from PubChem (CID 159731714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).