C15H21N3O2 — CID 144805378
ethane;5-piperazin-1-yl-1-benzofuran-2-carboxamide (PubChem CID 144805378) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethane;5-piperazin-1-yl-1-benzofuran-2-carboxamide.
| Compound Name | ethane;5-piperazin-1-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 144805378 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | ethane;5-piperazin-1-yl-1-benzofuran-2-carboxamide |
| SMILES | CC.NC(=O)c1cc2cc(N3CCNCC3)ccc2o1 |
| InChI | InChI=1S/C13H15N3O2.C2H6/c14-13(17)12-8-9-7-10(1-2-11(9)18-12)16-5-3-15-4-6-16;1-2/h1-2,7-8,15H,3-6H2,(H2,14,17);1-2H3 |
| InChIKey | NXZHITATZBYKNQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |