C11H13N3O — CID 82608582
5-piperazin-1-yl-1,2-benzoxazole (PubChem CID 82608582) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-piperazin-1-yl-1,2-benzoxazole.
| Compound Name | 5-piperazin-1-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 82608582 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-piperazin-1-yl-1,2-benzoxazole |
| SMILES | c1cc2oncc2cc1N1CCNCC1 |
| InChI | InChI=1S/C11H13N3O/c1-2-11-9(8-13-15-11)7-10(1)14-5-3-12-4-6-14/h1-2,7-8,12H,3-6H2 |
| InChIKey | TUJPMUITQGQQFR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |