About 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride
3-piperazin-1-yl-1,2-benzoxazole;hydrochloride (PubChem CID 13232476) has the molecular formula C11H14ClN3O
and a molecular weight of 239.71 g/mol. Its IUPAC name is 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride.
Molecular Properties
| Compound Name | 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride |
| PubChem CID | 13232476 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride |
| SMILES | Cl.c1ccc2c(N3CCNCC3)noc2c1 |
| InChI | InChI=1S/C11H13N3O.ClH/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14;/h1-4,12H,5-8H2;1H |
| InChIKey | QSXYQRWLEGCKEW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride?
The IUPAC name of 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride (CID 13232476) is 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride.
What is the SMILES notation for 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride?
The canonical SMILES for 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride is Cl.c1ccc2c(N3CCNCC3)noc2c1.
What is the InChIKey of 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride?
The InChIKey is QSXYQRWLEGCKEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.ClH/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14;/h1-4,12H,5-8H2;1H.
What are the key properties of 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride?
3-piperazin-1-yl-1,2-benzoxazole;hydrochloride has a molecular weight of 239.71 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-yl-1,2-benzoxazole;hydrochloride is sourced from PubChem (CID 13232476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).