C21H24FN3O2 — CID 13232490
4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-ol (PubChem CID 13232490) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-ol.
| Compound Name | 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 13232490 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-ol |
| SMILES | OC(CCCN1CCN(c2noc3ccccc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3O2/c22-17-9-7-16(8-10-17)19(26)5-3-11-24-12-14-25(15-13-24)21-18-4-1-2-6-20(18)27-23-21/h1-2,4,6-10,19,26H,3,5,11-15H2 |
| InChIKey | BBNORVNMDRYYOB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |