C18H23N3O4 — CID 11244883
tert-butyl 4-(2-carbamoyl-1-benzofuran-5-yl)piperazine-1-carboxylate (PubChem CID 11244883) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl 4-(2-carbamoyl-1-benzofuran-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-carbamoyl-1-benzofuran-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11244883 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl 4-(2-carbamoyl-1-benzofuran-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3oc(C(N)=O)cc3c2)CC1 |
| InChI | InChI=1S/C18H23N3O4/c1-18(2,3)25-17(23)21-8-6-20(7-9-21)13-4-5-14-12(10-13)11-15(24-14)16(19)22/h4-5,10-11H,6-9H2,1-3H3,(H2,19,22) |
| InChIKey | RXWUUFACDXGVIO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |