C19H13BrN6 — CID 91972630
3-(3-bromophenyl)-2-[2,2-dicyano-1-(propan-2-ylamino)ethenyl]cyclopropane-1,1,2-tricarbonitrile (PubChem CID 91972630) has the molecular formula C19H13BrN6 and a molecular weight of 405.26 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2-[2,2-dicyano-1-(propan-2-ylamino)ethenyl]cyclopropane-1,1,2-tricarbonitrile.
| Compound Name | 3-(3-bromophenyl)-2-[2,2-dicyano-1-(propan-2-ylamino)ethenyl]cyclopropane-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 91972630 |
| Molecular Formula | C19H13BrN6 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 3-(3-bromophenyl)-2-[2,2-dicyano-1-(propan-2-ylamino)ethenyl]cyclopropane-1,1,2-tricarbonitrile |
| SMILES | CC(C)NC(=C(C#N)C#N)C1(C#N)C(c2cccc(Br)c2)C1(C#N)C#N |
| InChI | InChI=1S/C19H13BrN6/c1-12(2)26-17(14(7-21)8-22)19(11-25)16(18(19,9-23)10-24)13-4-3-5-15(20)6-13/h3-6,12,16,26H,1-2H3 |
| InChIKey | JHTOBOLMISIACT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|