C16H21BrN2S — CID 79636562
3-(3-bromophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carbonitrile (PubChem CID 79636562) has the molecular formula C16H21BrN2S and a molecular weight of 353.33 g/mol. Its IUPAC name is 3-(3-bromophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carbonitrile.
| Compound Name | 3-(3-bromophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79636562 |
| Molecular Formula | C16H21BrN2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(3-bromophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carbonitrile |
| SMILES | CC(C)NC1(C#N)CCCC(Sc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H21BrN2S/c1-12(2)19-16(11-18)8-4-7-15(10-16)20-14-6-3-5-13(17)9-14/h3,5-6,9,12,15,19H,4,7-8,10H2,1-2H3 |
| InChIKey | ZEGVUXGOPRCPMS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |