C18H26N2S — CID 79644862
1-(propan-2-ylamino)-3-(4-propan-2-ylphenyl)sulfanylcyclopentane-1-carbonitrile (PubChem CID 79644862) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is 1-(propan-2-ylamino)-3-(4-propan-2-ylphenyl)sulfanylcyclopentane-1-carbonitrile.
| Compound Name | 1-(propan-2-ylamino)-3-(4-propan-2-ylphenyl)sulfanylcyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79644862 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-(propan-2-ylamino)-3-(4-propan-2-ylphenyl)sulfanylcyclopentane-1-carbonitrile |
| SMILES | CC(C)NC1(C#N)CCC(Sc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C18H26N2S/c1-13(2)15-5-7-16(8-6-15)21-17-9-10-18(11-17,12-19)20-14(3)4/h5-8,13-14,17,20H,9-11H2,1-4H3 |
| InChIKey | HPXYFGXUUMJXHE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |