About 3-methylcyclopropen-1-ol
3-methylcyclopropen-1-ol (PubChem CID 173486632) has the molecular formula C4H6O
and a molecular weight of 70.09 g/mol. Its IUPAC name is 3-methylcyclopropen-1-ol.
Molecular Properties
| Compound Name | 3-methylcyclopropen-1-ol |
| PubChem CID | 173486632 |
| Molecular Formula | C4H6O |
| Molecular Weight | 70.09 g/mol |
| Exact Mass | 70.04 |
| IUPAC Name | 3-methylcyclopropen-1-ol |
| SMILES | CC1C=C1O |
| InChI | InChI=1S/C4H6O/c1-3-2-4(3)5/h2-3,5H,1H3 |
| InChIKey | VISOOGZURUCERZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 70.09 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylcyclopropen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopropen-1-ol?
The IUPAC name of 3-methylcyclopropen-1-ol (CID 173486632) is 3-methylcyclopropen-1-ol.
What is the SMILES notation for 3-methylcyclopropen-1-ol?
The canonical SMILES for 3-methylcyclopropen-1-ol is CC1C=C1O.
What is the InChIKey of 3-methylcyclopropen-1-ol?
The InChIKey is VISOOGZURUCERZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O/c1-3-2-4(3)5/h2-3,5H,1H3.
What are the key properties of 3-methylcyclopropen-1-ol?
3-methylcyclopropen-1-ol has a molecular weight of 70.09 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopropen-1-ol is sourced from PubChem (CID 173486632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).