C9H14O — CID 89168484
4-ethyl-6-methylcyclohexa-1,3-dien-1-ol (PubChem CID 89168484) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-ethyl-6-methylcyclohexa-1,3-dien-1-ol.
| Compound Name | 4-ethyl-6-methylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 89168484 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 4-ethyl-6-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CCC1=CC=C(O)C(C)C1 |
| InChI | InChI=1S/C9H14O/c1-3-8-4-5-9(10)7(2)6-8/h4-5,7,10H,3,6H2,1-2H3 |
| InChIKey | RSMCSPXJNHMVGG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |