C14H24 — CID 143221988
(Z)-but-2-ene;1,4-diethylcyclohexa-1,3-diene (PubChem CID 143221988) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (Z)-but-2-ene;1,4-diethylcyclohexa-1,3-diene.
| Compound Name | (Z)-but-2-ene;1,4-diethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143221988 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (Z)-but-2-ene;1,4-diethylcyclohexa-1,3-diene |
| SMILES | C/C=C\C.CCC1=CC=C(CC)CC1 |
| InChI | InChI=1S/C10H16.C4H8/c1-3-9-5-7-10(4-2)8-6-9;1-3-4-2/h5,7H,3-4,6,8H2,1-2H3;3-4H,1-2H3/b;4-3- |
| InChIKey | OFLJUCVDDQQNMW-QGAMPUOQSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|